
CAS 886494-58-2
:1-[5-(2-Amino-4-chlorophenyl)-2-furanyl]ethanone
Description:
1-[5-(2-Amino-4-chlorophenyl)-2-furanyl]ethanone, with the CAS number 886494-58-2, is an organic compound characterized by its unique structural features. It contains a furan ring, which is a five-membered aromatic heterocycle, and an ethanone functional group, indicating the presence of a ketone. The compound also features a 2-amino-4-chlorophenyl substituent, which contributes to its biological activity and potential pharmacological properties. The presence of the amino group suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the chlorophenyl moiety can affect the compound's electronic properties and stability. This compound may exhibit interesting interactions with biological targets, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 1-[5-(2-Amino-4-chlorophenyl)-2-furanyl]ethanone represents a complex structure with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C12H10ClNO2
InChI:InChI=1S/C12H10ClNO2/c1-7(15)11-4-5-12(16-11)9-3-2-8(13)6-10(9)14/h2-6H,14H2,1H3
InChI key:InChIKey=ZPBJGFNEPUZZGK-UHFFFAOYSA-N
SMILES:NC1=C(C=2OC(C(C)=O)=CC2)C=CC(Cl)=C1
Synonyms:- 1-[5-(2-Amino-4-chlorophenyl)-2-furanyl]ethanone
- Ethanone, 1-[5-(2-amino-4-chlorophenyl)-2-furanyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.