CAS 886494-69-5

4-Chloro-3-(1-piperidinyl)benzoic acid hydrazide

Description:

4-Chloro-3-(1-piperidinyl)benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from the reaction of hydrazine with a carboxylic acid. This compound features a benzoic acid moiety substituted with a chlorine atom at the para position and a piperidine ring at the meta position, contributing to its unique chemical properties. The presence of the piperidine group enhances its potential for biological activity, making it of interest in pharmaceutical research. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid and hydrazide functionalities. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many hydrazides, it may also exhibit reactivity towards electrophiles, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health risks.

Formula: C₁₂H₁₆ClN₃O

InChI: InChI=1S/C12H16ClN3O/c13-10-5-4-9(12(17)15-14)8-11(10)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7,14H2,(H,15,17)

InChI key: InChIKey=FYAUWWKTODRZGJ-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(C(NN)=O)=CC1)N2CCCCC2

Synonyms:

• Benzoic acid, 4-chloro-3-(1-piperidinyl)-, hydrazide
• 4-Chloro-3-(1-piperidinyl)benzoic acid hydrazide