CymitQuimica logo

CAS 886495-00-7

:

4-(2-Bromo-4-fluorophenyl)-2-thiazolamine

Description:
4-(2-Bromo-4-fluorophenyl)-2-thiazolamine is a chemical compound characterized by its thiazole ring and substituted aromatic structure. The presence of a bromine and a fluorine atom on the phenyl group contributes to its unique reactivity and potential biological activity. Thiazolamines are known for their diverse applications in medicinal chemistry, often exhibiting antimicrobial, anti-inflammatory, or anticancer properties. The specific substitution pattern of this compound may influence its solubility, stability, and interaction with biological targets. Additionally, the presence of halogens like bromine and fluorine can enhance lipophilicity and alter the electronic properties of the molecule, which may be beneficial in drug design. As with many thiazole derivatives, this compound may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety and handling precautions should be observed due to the potential hazards associated with halogenated compounds.
Formula:C9H6BrFN2S
InChI:InChI=1S/C9H6BrFN2S/c10-7-3-5(11)1-2-6(7)8-4-14-9(12)13-8/h1-4H,(H2,12,13)
InChI key:InChIKey=PSRWENGYZYMRSP-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC(F)=C1)C=2N=C(N)SC2
Synonyms:
  • 2-Thiazolamine, 4-(2-bromo-4-fluorophenyl)-
  • 4-(2-Bromo-4-fluorophenyl)-2-thiazolamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.