
CAS 886495-83-6
:Thiazole, 4-(2,5-dichlorophenyl)-2-hydrazinyl-
Description:
Thiazole, 4-(2,5-dichlorophenyl)-2-hydrazinyl- is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a hydrazine group (-NH-NH2) at the 2-position of the thiazole contributes to its reactivity and potential biological activity. The 2,5-dichlorophenyl substituent at the 4-position enhances its lipophilicity and may influence its interaction with biological targets. This compound may exhibit various properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Its molecular structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its solubility and stability. Additionally, the presence of chlorine atoms can impact the compound's electronic properties and reactivity. As with many thiazole derivatives, the specific characteristics and applications of this compound would depend on further experimental studies and evaluations.
Formula:C9H7Cl2N3S
InChI:InChI=1S/C9H7Cl2N3S/c10-5-1-2-7(11)6(3-5)8-4-15-9(13-8)14-12/h1-4H,12H2,(H,13,14)
InChI key:InChIKey=SOAZZNPIZKCAFU-UHFFFAOYSA-N
SMILES:ClC1=C(C=2NC(=NN)SC2)C=C(Cl)C=C1
Synonyms:- 2(3H)-Thiazolone, 4-(2,5-dichlorophenyl)-, hydrazone
- 4-(2,5-Dichlorophenyl)-2-hydrazinylthiazole
- [4-(2,5-Dichloro-phenyl)-thiazol-2-yl]-hydrazine
- Thiazole, 4-(2,5-dichlorophenyl)-2-hydrazinyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.