CymitQuimica logo

CAS 886495-85-8

:

3-(5-Methyl-4-phenyl-2-thiazolyl)benzenamine

Description:
3-(5-Methyl-4-phenyl-2-thiazolyl)benzenamine, with the CAS number 886495-85-8, is an organic compound characterized by its thiazole and aniline functional groups. The thiazole ring contributes to its heterocyclic nature, while the aniline portion provides basic amine characteristics. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic aromatic components. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the methyl and phenyl substituents can influence its electronic properties and steric hindrance, potentially affecting its reactivity and interactions with biological targets. Additionally, compounds like this may undergo various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, depending on the conditions. Safety and handling precautions are essential, as with many organic compounds, to mitigate any potential health risks associated with exposure.
Formula:C16H14N2S
InChI:InChI=1S/C16H14N2S/c1-11-15(12-6-3-2-4-7-12)18-16(19-11)13-8-5-9-14(17)10-13/h2-10H,17H2,1H3
InChI key:InChIKey=LBPPWPSAODWWKG-UHFFFAOYSA-N
SMILES:CC=1SC(=NC1C2=CC=CC=C2)C3=CC(N)=CC=C3
Synonyms:
  • 3-(5-Methyl-4-phenyl-2-thiazolyl)benzenamine
  • Benzenamine, 3-(5-methyl-4-phenyl-2-thiazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.