CymitQuimica logo

CAS 886496-03-3

:

3,6-Dicyclopropyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide

Description:
3,6-Dicyclopropyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core, a phenyl group, and two cyclopropyl substituents. This compound features a hydrazide functional group, which is known for its reactivity and potential biological activity. The presence of the carboxylic acid moiety suggests that it may exhibit acidic properties, while the hydrazide can participate in various chemical reactions, including condensation and hydrazone formation. The cyclopropyl groups contribute to the compound's steric and electronic properties, potentially influencing its interactions with biological targets. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to the development of novel pharmaceuticals. However, specific biological activities, solubility, stability, and other physicochemical properties would require empirical investigation to fully characterize its potential applications.
Formula:C19H19N5O
InChI:InChI=1S/C19H19N5O/c20-22-19(25)14-10-15(11-6-7-11)21-18-16(14)17(12-8-9-12)23-24(18)13-4-2-1-3-5-13/h1-5,10-12H,6-9,20H2,(H,22,25)
InChI key:InChIKey=KFVOCHVKQPMRCO-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=C2C(N(N=C2C3CC3)C4=CC=CC=C4)=NC(=C1)C5CC5
Synonyms:
  • 3,6-Dicyclopropyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid hydrazide
  • 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 3,6-dicyclopropyl-1-phenyl-, hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.