CymitQuimica logo

CAS 886496-21-5

:

α-(1,1,2,2,2-Pentafluoroethyl)-2-pyridinemethanol

Description:
α-(1,1,2,2,2-Pentafluoroethyl)-2-pyridinemethanol is a chemical compound characterized by its unique structure, which includes a pyridine ring and a pentafluoroethyl group. This compound typically exhibits properties associated with both its aromatic and fluorinated components. The presence of the fluorinated group often imparts increased stability, hydrophobicity, and potential bioactivity, making it of interest in various chemical and pharmaceutical applications. The hydroxyl group in the pyridinemethanol portion can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may display interesting electronic properties due to the electron-withdrawing nature of the fluorine atoms, which can affect its interaction with biological targets or other chemical species. Overall, α-(1,1,2,2,2-Pentafluoroethyl)-2-pyridinemethanol is a compound of interest in research fields such as medicinal chemistry and materials science, where its unique characteristics can be leveraged for specific applications.
Formula:C8H6F5NO
InChI:InChI=1S/C8H6F5NO/c9-7(10,8(11,12)13)6(15)5-3-1-2-4-14-5/h1-4,6,15H
InChI key:InChIKey=HVCIJUHXCQINBC-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)(F)F)(O)C1=CC=CC=N1
Synonyms:
  • 2-Pyridinemethanol, α-(pentafluoroethyl)-
  • α-(1,1,2,2,2-Pentafluoroethyl)-2-pyridinemethanol
  • 2-Pyridinemethanol, α-(1,1,2,2,2-pentafluoroethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.