CAS 886496-22-6

3-[4-(3-Bromophenyl)-2-thiazolyl]benzenamine

Description:

3-[4-(3-Bromophenyl)-2-thiazolyl]benzenamine, identified by its CAS number 886496-22-6, is an organic compound characterized by its complex structure that includes a thiazole ring and an aniline moiety. The presence of a bromophenyl group introduces significant lipophilicity and potential for various chemical interactions, making it of interest in medicinal chemistry and material science. This compound typically exhibits properties such as moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. The thiazole ring contributes to its potential biological activity, as thiazoles are often found in biologically active compounds. Additionally, the amine functional group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical measurement or detailed literature references for precise characterization.

Formula: C₁₅H₁₁BrN₂S

InChI: InChI=1S/C15H11BrN2S/c16-12-5-1-3-10(7-12)14-9-19-15(18-14)11-4-2-6-13(17)8-11/h1-9H,17H2

InChI key: InChIKey=VQTNSFDUMDAJIF-UHFFFAOYSA-N

SMILES: BrC=1C=C(C=2N=C(SC2)C3=CC(N)=CC=C3)C=CC1

Synonyms:

• Benzenamine, 3-[4-(3-bromophenyl)-2-thiazolyl]-
• 3-[4-(3-Bromophenyl)-2-thiazolyl]benzenamine