CAS 886496-24-8
:α-(1,1,2,2,2-Pentafluoroethyl)-4-pyridinemethanol
Description:
α-(1,1,2,2,2-Pentafluoroethyl)-4-pyridinemethanol, with the CAS number 886496-24-8, is a chemical compound characterized by its unique structure that combines a pyridine ring with a pentafluoroethyl group and a hydroxymethyl substituent. This compound is notable for its high fluorine content, which imparts distinct physical and chemical properties, such as increased hydrophobicity and thermal stability. The presence of the hydroxymethyl group enhances its potential for hydrogen bonding, influencing its solubility and reactivity. Typically, compounds with such fluorinated groups exhibit low volatility and high resistance to oxidation and degradation. The pyridine moiety contributes to its basicity and potential interactions in various chemical environments. This compound may find applications in pharmaceuticals, agrochemicals, or as a specialty chemical due to its unique properties. However, specific safety and handling guidelines should be followed, as fluorinated compounds can pose environmental and health risks.
Formula:C8H6F5NO
InChI:InChI=1S/C8H6F5NO/c9-7(10,8(11,12)13)6(15)5-1-3-14-4-2-5/h1-4,6,15H
InChI key:InChIKey=GHROSUKBCNXPBP-UHFFFAOYSA-N
SMILES:C(C(C(F)(F)F)(F)F)(O)C=1C=CN=CC1
Synonyms:- α-(1,1,2,2,2-Pentafluoroethyl)-4-pyridinemethanol
- 4-Pyridinemethanol, α-(pentafluoroethyl)-
- 4-Pyridinemethanol, α-(1,1,2,2,2-pentafluoroethyl)-
- 2,2-Difluoro-1-(3,3,3-trifluoro-3,4-dihydro-3λ5-pyridin-4-yl)ethan-1-ol
- 2,2,3,3,3-PENTAFLUORO-1-PYRIDIN-4-YL-ETHANOL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.