CAS 886496-25-9

Benzenamine, 3-[4-(4-bromophenyl)-2-thiazolyl]-

Description:

Benzenamine, 3-[4-(4-bromophenyl)-2-thiazolyl]- is an organic compound characterized by its amine functional group and a thiazole ring, which contributes to its chemical reactivity and potential biological activity. The presence of the bromophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its aromatic nature. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anticancer properties. The thiazole moiety is known for its role in various biological activities, making this compound of interest in medicinal chemistry. Additionally, the presence of bromine can introduce unique electronic properties, affecting the compound's reactivity and stability. Safety and handling precautions should be observed due to the potential toxicity associated with amines and halogenated compounds. Overall, Benzenamine, 3-[4-(4-bromophenyl)-2-thiazolyl]- represents a class of compounds that may offer valuable insights in chemical research and drug development.

Formula: C₁₅H₁₁BrN₂S

InChI: InChI=1S/C15H11BrN2S/c16-12-6-4-10(5-7-12)14-9-19-15(18-14)11-2-1-3-13(17)8-11/h1-9H,17H2

InChI key: InChIKey=YJSZFJFVTYLCMW-UHFFFAOYSA-N

SMILES: BrC1=CC=C(C=2N=C(SC2)C3=CC(N)=CC=C3)C=C1

Synonyms:

• Benzenamine, 3-[4-(4-bromophenyl)-2-thiazolyl]-