CAS 886496-32-8

Ethyl 3-[5-(2-methoxy-4-nitrophenyl)-2-furanyl]-2-propenoate

Description:

Ethyl 3-[5-(2-methoxy-4-nitrophenyl)-2-furanyl]-2-propenoate is an organic compound characterized by its complex structure, which includes an ethyl ester group, a furan ring, and a nitrophenyl substituent. This compound typically exhibits properties associated with both furan and aromatic systems, such as potential reactivity in electrophilic substitution reactions due to the presence of the nitro group. The methoxy group enhances the electron-donating characteristics of the aromatic system, influencing its reactivity and solubility. Ethyl 3-[5-(2-methoxy-4-nitrophenyl)-2-furanyl]-2-propenoate may also display interesting optical properties due to its conjugated double bond system, which can absorb light in the UV-visible spectrum. Additionally, the presence of multiple functional groups suggests potential applications in organic synthesis, pharmaceuticals, or as a precursor in the development of more complex molecules. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.

Formula: C₁₆H₁₅NO₆

InChI: InChI=1S/C16H15NO6/c1-3-22-16(18)9-6-12-5-8-14(23-12)13-7-4-11(17(19)20)10-15(13)21-2/h4-10H,3H2,1-2H3

InChI key: InChIKey=BCYCYZAYPVUGKO-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC(N(=O)=O)=C1)C=2OC(C=CC(OCC)=O)=CC2

Synonyms:

• 2-Propenoic acid, 3-[5-(2-methoxy-4-nitrophenyl)-2-furanyl]-, ethyl ester
• Ethyl 3-[5-(2-methoxy-4-nitrophenyl)-2-furanyl]-2-propenoate