
CAS 886496-38-4
:Ethyl 3-[5-(2-chloro-5-nitrophenyl)-2-furanyl]-2-propenoate
Description:
Ethyl 3-[5-(2-chloro-5-nitrophenyl)-2-furanyl]-2-propenoate is an organic compound characterized by its complex structure, which includes a furan ring, a nitrophenyl group, and an ethyl ester functional group. This compound features a propenoate moiety, indicating it has an unsaturated carbon-carbon double bond, which can participate in various chemical reactions, such as polymerization or addition reactions. The presence of the chloro and nitro substituents on the phenyl ring contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry and materials science. The furan ring adds to the compound's aromatic character and can influence its solubility and stability. Ethyl 3-[5-(2-chloro-5-nitrophenyl)-2-furanyl]-2-propenoate may exhibit specific physical properties such as melting and boiling points, solubility in organic solvents, and potential applications in synthesis or as an intermediate in chemical reactions. Its unique structure suggests potential uses in pharmaceuticals or agrochemicals, although specific applications would depend on further research and testing.
Formula:C15H12ClNO5
InChI:InChI=1S/C15H12ClNO5/c1-2-21-15(18)8-5-11-4-7-14(22-11)12-9-10(17(19)20)3-6-13(12)16/h3-9H,2H2,1H3
InChI key:InChIKey=QBTVZENXUGTGQZ-UHFFFAOYSA-N
SMILES:ClC=1C(C=2OC(C=CC(OCC)=O)=CC2)=CC(N(=O)=O)=CC1
Synonyms:- Ethyl 3-[5-(2-chloro-5-nitrophenyl)-2-furanyl]-2-propenoate
- 2-Propenoic acid, 3-[5-(2-chloro-5-nitrophenyl)-2-furanyl]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.