CAS 886496-50-0
:5-(Benzoylamino)-2-methoxybenzenesulfonyl chloride
Description:
5-(Benzoylamino)-2-methoxybenzenesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features a benzoylamino group, indicating the presence of an amide linkage between a benzoyl group and an amino group, contributing to its potential as a coupling agent in peptide synthesis or other amide-forming reactions. The methoxy group enhances its solubility in organic solvents and may influence its reactivity. As a sulfonyl chloride, it can act as a potent electrophile, making it useful in the synthesis of sulfonamides and other derivatives. The compound is likely to be a solid at room temperature, with a specific melting point and solubility characteristics that depend on the solvent used. Safety precautions should be taken when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or alcohols. Overall, its unique structure and functional groups make it a valuable intermediate in various chemical reactions.
Formula:C14H12ClNO4S
InChI:InChI=1S/C14H12ClNO4S/c1-20-12-8-7-11(9-13(12)21(15,18)19)16-14(17)10-5-3-2-4-6-10/h2-9H,1H3,(H,16,17)
InChI key:InChIKey=VAUJRQAIEKQWGV-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(OC)C=CC(NC(=O)C2=CC=CC=C2)=C1
Synonyms:- Benzenesulfonyl chloride, 5-(benzoylamino)-2-methoxy-
- 5-(Benzoylamino)-2-methoxybenzenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.