CAS 886496-51-1

3-[4-(3-Methylphenyl)-2-thiazolyl]benzenamine

Description:

3-[4-(3-Methylphenyl)-2-thiazolyl]benzenamine, with the CAS number 886496-51-1, is an organic compound characterized by its complex structure that includes a thiazole ring and an aniline moiety. This compound features a thiazole group, which is a five-membered heterocyclic ring containing both sulfur and nitrogen, contributing to its potential biological activity. The presence of the 3-methylphenyl substituent enhances its hydrophobic characteristics, which can influence its solubility and interaction with biological systems. The amine functional group in the benzenamine part of the molecule can participate in hydrogen bonding, making it a potential candidate for various chemical reactions and applications in medicinal chemistry. Its structural features suggest that it may exhibit interesting pharmacological properties, although specific biological activities would require empirical investigation. Overall, this compound's unique combination of functional groups and structural elements positions it as a subject of interest in the fields of organic synthesis and drug development.

Formula: C₁₆H₁₄N₂S

InChI: InChI=1S/C16H14N2S/c1-11-4-2-5-12(8-11)15-10-19-16(18-15)13-6-3-7-14(17)9-13/h2-10H,17H2,1H3

InChI key: InChIKey=DYRAWLOXEPXNGD-UHFFFAOYSA-N

SMILES: CC=1C=C(C=2N=C(SC2)C3=CC(N)=CC=C3)C=CC1

Synonyms:

• 3-[4-(3-Methylphenyl)-2-thiazolyl]benzenamine
• Benzenamine, 3-[4-(3-methylphenyl)-2-thiazolyl]-