CAS 886496-56-6
:4-Thiazolecarboxylic acid, 2-[(4-nitrophenyl)amino]-
Description:
4-Thiazolecarboxylic acid, 2-[(4-nitrophenyl)amino]- is an organic compound characterized by its thiazole and nitrophenyl functional groups. The thiazole ring contributes to its heterocyclic nature, which often imparts unique chemical reactivity and biological activity. The presence of the carboxylic acid group (-COOH) indicates that it can act as an acid, participating in proton transfer reactions and forming salts or esters. The 4-nitrophenylamino group enhances the compound's potential for interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties such as solubility in polar solvents, and its structure suggests potential for hydrogen bonding due to the carboxylic acid and amino functionalities. Additionally, the nitro group can influence the electronic properties of the molecule, potentially affecting its reactivity and interactions. Overall, this compound's unique structural features make it a candidate for various applications, including pharmaceuticals and agrochemicals, although specific biological activities would require further investigation.
Formula:C10H7N3O4S
InChI:InChI=1S/C10H7N3O4S/c14-9(15)8-5-18-10(12-8)11-6-1-3-7(4-2-6)13(16)17/h1-5H,(H,11,12)(H,14,15)
InChI key:InChIKey=PGLWAUKTPVYTHD-UHFFFAOYSA-N
SMILES:N(C1=NC(C(O)=O)=CS1)C2=CC=C(N(=O)=O)C=C2
Synonyms:- 2-(4-Nitrophenylamino)thiazole-4-carboxylic acid
- 2-(4-Nitro-phenylamino)-thiazole-4-carboxylic acid
- 4-Thiazolecarboxylic acid, 2-[(4-nitrophenyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.