CAS 886496-70-4

4-[(3,4-Dichlorobenzoyl)amino]-1-methyl-1H-pyrrole-2-carboxylic acid

Description:

4-[(3,4-Dichlorobenzoyl)amino]-1-methyl-1H-pyrrole-2-carboxylic acid, with the CAS number 886496-70-4, is a chemical compound characterized by its complex structure, which includes a pyrrole ring substituted with a carboxylic acid group and an amide linkage to a dichlorobenzoyl moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both the carboxylic acid and amide functional groups. The dichlorobenzoyl group may impart specific electronic and steric effects, influencing its biological activity and interactions. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The presence of halogen atoms, like chlorine, can also affect the compound's lipophilicity and metabolic stability. Overall, this substance represents a class of organic molecules that may possess significant therapeutic potential, warranting further investigation into its biological properties and mechanisms of action.

Formula: C₁₃H₁₀Cl₂N₂O₃

InChI: InChI=1S/C13H10Cl2N2O3/c1-17-6-8(5-11(17)13(19)20)16-12(18)7-2-3-9(14)10(15)4-7/h2-6H,1H3,(H,16,18)(H,19,20)

InChI key: InChIKey=UJHUMEYJIHQQRE-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC(Cl)=C(Cl)C=C1)C=2C=C(C(O)=O)N(C)C2

Synonyms:

• 4-[(3,4-Dichlorobenzoyl)amino]-1-methyl-1H-pyrrole-2-carboxylic acid
• 1H-Pyrrole-2-carboxylic acid, 4-[(3,4-dichlorobenzoyl)amino]-1-methyl-

4-(3,4-Dichloro-benzoylamino)-1-methyl-1H-pyrrole-2-carboxylic acid

CAS: 886496-70-4

Formula: C₁₃H₁₀Cl₂N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 313.13

Ref: 10-F021355