CAS 886496-96-4

1-[(4-Methoxyphenyl)amino]cyclohexanecarboxylic acid

Description:

1-[(4-Methoxyphenyl)amino]cyclohexanecarboxylic acid, with the CAS number 886496-96-4, is a chemical compound characterized by its unique structure, which includes a cyclohexane ring substituted with an amino group and a carboxylic acid functional group. The presence of the 4-methoxyphenyl group enhances its potential for various biological activities, as methoxy groups can influence the compound's solubility and reactivity. This compound is likely to exhibit properties typical of amino acids and aromatic compounds, such as potential interactions with biological receptors and enzymes. Its carboxylic acid functionality suggests it can participate in acid-base reactions, while the amino group may allow for hydrogen bonding and interactions with other polar molecules. The compound's structural features may also contribute to its stability and reactivity under different conditions, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to fully elucidate its pharmacological properties and potential applications.

Formula: C₁₄H₁₉NO₃

InChI: InChI=1S/C14H19NO3/c1-18-12-7-5-11(6-8-12)15-14(13(16)17)9-3-2-4-10-14/h5-8,15H,2-4,9-10H2,1H3,(H,16,17)

InChI key: InChIKey=NZMAVUAAODMKSH-UHFFFAOYSA-N

SMILES: N(C1(C(O)=O)CCCCC1)C2=CC=C(OC)C=C2

Synonyms:

• Cyclohexanecarboxylic acid, 1-[(4-methoxyphenyl)amino]-
• 1-[(4-Methoxyphenyl)amino]cyclohexanecarboxylic acid