CymitQuimica logo

CAS 886496-99-7

:

3-Chloro-5-(trifluoromethyl)benzeneacetic acid

Description:
3-Chloro-5-(trifluoromethyl)benzeneacetic acid, with the CAS number 886496-99-7, is an aromatic carboxylic acid characterized by the presence of a chloro group and a trifluoromethyl group on a benzene ring. This compound features a benzene ring substituted at the 3-position with a chlorine atom and at the 5-position with a trifluoromethyl group, which significantly influences its chemical properties and reactivity. The carboxylic acid functional group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of the electronegative trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the chlorine atom can influence the compound's stability and reactivity. Overall, this compound's unique structure contributes to its potential applications in synthetic chemistry and material science.
Formula:C9H6ClF3O2
InChI:InChI=1S/C9H6ClF3O2/c10-7-2-5(3-8(14)15)1-6(4-7)9(11,12)13/h1-2,4H,3H2,(H,14,15)
InChI key:InChIKey=VEEZRFPBIRDYOE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CC(O)=O)=CC(Cl)=C1
Synonyms:
  • (3-Chloro-5-(trifluoromethyl)phenyl)acetic acid
  • 2-[3-Chloro-5-(Trifluoromethyl)Phenyl]Acetic Acid
  • 3-Chloro-5-(trifluoromethyl)benzeneacetic acid
  • 3-Chloro-5-(trifluoromethyl)benzoic acid
  • Benzeneacetic acid, 3-chloro-5-(trifluoromethyl)-
  • 3-Chloro-5-(trifluoromethyl)phenylacetic acid
Found 4 products.