CymitQuimica logo

CAS 886497-06-9

:

5-(2,4,5-Trimethylphenyl)-1,2,4-triazin-3-amine

Description:
5-(2,4,5-Trimethylphenyl)-1,2,4-triazin-3-amine is a chemical compound characterized by its triazine core, which consists of a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features a 2,4,5-trimethylphenyl group, which contributes to its hydrophobic characteristics and influences its solubility and reactivity. The presence of the amino group (-NH2) at the 3-position of the triazine ring suggests potential for hydrogen bonding and reactivity in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure allows for various interactions with biological targets, potentially leading to applications in drug development or as a pesticide. The compound's stability, solubility, and reactivity can be influenced by environmental factors, such as pH and temperature, and it may undergo transformations under specific conditions. Overall, 5-(2,4,5-trimethylphenyl)-1,2,4-triazin-3-amine represents a versatile structure in organic chemistry with potential applications in multiple fields.
Formula:C12H14N4
InChI:InChI=1S/C12H14N4/c1-7-4-9(3)10(5-8(7)2)11-6-14-16-12(13)15-11/h4-6H,1-3H3,(H2,13,15,16)
InChI key:InChIKey=GRJWIQFCLPOCAB-UHFFFAOYSA-N
SMILES:CC1=C(C2=NC(N)=NN=C2)C=C(C)C(C)=C1
Synonyms:
  • 1,2,4-Triazin-3-amine, 5-(2,4,5-trimethylphenyl)-
  • 5-(2,4,5-Trimethylphenyl)-1,2,4-triazin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.