
CAS 886497-23-0
:Methyl 4-[5-(2-benzothiazolyl)-2-furanyl]benzoate
Description:
Methyl 4-[5-(2-benzothiazolyl)-2-furanyl]benzoate is an organic compound characterized by its complex structure, which includes a methyl ester functional group, a benzothiazole moiety, and a furan ring. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitutions. The presence of the benzothiazole and furan rings suggests that it may possess interesting electronic properties, potentially making it useful in applications such as organic electronics or as a fluorescent probe. Additionally, the methyl ester group can influence its solubility and reactivity, making it amenable to further chemical modifications. The compound may also exhibit biological activity, which is common for derivatives of benzothiazole and furan, often being explored for pharmaceutical applications. Overall, Methyl 4-[5-(2-benzothiazolyl)-2-furanyl]benzoate is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C19H13NO3S
InChI:InChI=1S/C19H13NO3S/c1-22-19(21)13-8-6-12(7-9-13)15-10-11-16(23-15)18-20-14-4-2-3-5-17(14)24-18/h2-11H,1H3
InChI key:InChIKey=RXCBCMRRLHUPBJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC=C(C=2OC(C3=NC=4C(S3)=CC=CC4)=CC2)C=C1
Synonyms:- Benzoic acid, 4-[5-(2-benzothiazolyl)-2-furanyl]-, methyl ester
- Methyl 4-[5-(2-benzothiazolyl)-2-furanyl]benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.