CAS 886497-31-0

Ethyl 2-(1H-indol-3-yl)-4-methyl-5-thiazolecarboxylate

Description:

Ethyl 2-(1H-indol-3-yl)-4-methyl-5-thiazolecarboxylate is a chemical compound characterized by its complex structure, which includes an indole moiety and a thiazole ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of both polar and non-polar functional groups. The thiazole and indole components may impart unique reactivity, making it of interest in medicinal chemistry for potential pharmacological applications. Additionally, the ethyl ester group can influence its lipophilicity and bioavailability. As with many compounds containing heterocycles, it may exhibit interesting electronic properties, which could be relevant in the development of organic electronic materials or as a precursor in synthetic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₅H₁₄N₂O₂S

InChI: InChI=1S/C15H14N2O2S/c1-3-19-15(18)13-9(2)17-14(20-13)11-8-16-12-7-5-4-6-10(11)12/h4-8,16H,3H2,1-2H3

InChI key: InChIKey=HCDJPXTYNKXBHO-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(C=2C=3C(NC2)=CC=CC3)=NC1C

Synonyms:

• Ethyl 2-(1H-indol-3-yl)-4-methyl-5-thiazolecarboxylate
• 5-Thiazolecarboxylic acid, 2-(1H-indol-3-yl)-4-methyl-, ethyl ester