CymitQuimica logo

CAS 886497-34-3

:

Ethyl 2,3-dihydro-4-(3-methylphenyl)-2-oxo-5-thiazolecarboxylate

Description:
Ethyl 2,3-dihydro-4-(3-methylphenyl)-2-oxo-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which contributes to its biological activity and potential applications in medicinal chemistry. This compound features an ethyl ester functional group, enhancing its solubility and reactivity. The presence of a 3-methylphenyl substituent indicates that it may exhibit aromatic properties, which can influence its interactions with biological targets. The thiazole moiety is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory effects. Additionally, the compound's structure suggests it may participate in various chemical reactions, such as esterification or nucleophilic substitutions, making it a versatile intermediate in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique structure with potential implications in drug development and organic synthesis.
Formula:C13H13NO3S
InChI:InChI=1S/C13H13NO3S/c1-3-17-12(15)11-10(14-13(16)18-11)9-6-4-5-8(2)7-9/h4-7H,3H2,1-2H3,(H,14,16)
InChI key:InChIKey=PRPSAATZNUEWJZ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(NC(=O)S1)C2=CC(C)=CC=C2
Synonyms:
  • Ethyl 2,3-dihydro-4-(3-methylphenyl)-2-oxo-5-thiazolecarboxylate
  • 5-Thiazolecarboxylic acid, 2,3-dihydro-4-(3-methylphenyl)-2-oxo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.