CAS 886497-41-2
:Ethyl 4-(4-fluorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate
Description:
Ethyl 4-(4-fluorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity and potential applications in medicinal chemistry. The presence of a fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many thiazole derivatives. Its molecular structure suggests potential reactivity due to the presence of the carbonyl and ester functional groups, making it a candidate for further chemical modifications. Ethyl 4-(4-fluorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate may also display interesting pharmacological properties, including antimicrobial or anti-inflammatory activities, although specific biological data would need to be referenced for detailed insights. Overall, this compound represents a class of thiazole derivatives that are of interest in the field of organic synthesis and drug development.
Formula:C12H10FNO3S
InChI:InChI=1S/C12H10FNO3S/c1-2-17-11(15)10-9(14-12(16)18-10)7-3-5-8(13)6-4-7/h3-6H,2H2,1H3,(H,14,16)
InChI key:InChIKey=PKKNEYUMWTWJPA-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(NC(=O)S1)C2=CC=C(F)C=C2
Synonyms:- 5-Thiazolecarboxylic acid, 4-(4-fluorophenyl)-2,3-dihydro-2-oxo-, ethyl ester
- Ethyl 4-(4-fluorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.