CymitQuimica logo

CAS 886497-42-3

:

5-(4-Nitrophenyl)-1,2,4-triazin-3-amine

Description:
5-(4-Nitrophenyl)-1,2,4-triazin-3-amine is an organic compound characterized by its triazine ring structure, which contains three nitrogen atoms in a six-membered ring. The presence of a 4-nitrophenyl group indicates that there is a nitro substituent on a phenyl ring, contributing to the compound's potential reactivity and polarity. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The nitro group is known for its electron-withdrawing effects, which can influence the compound's reactivity in various chemical reactions, including nucleophilic substitutions and reductions. Additionally, the triazine moiety is often associated with biological activity, making such compounds of interest in pharmaceutical and agrochemical research. Safety data and handling precautions should be considered, as nitro compounds can be hazardous. Overall, 5-(4-Nitrophenyl)-1,2,4-triazin-3-amine is a compound of interest for its structural features and potential applications in various fields.
Formula:C9H7N5O2
InChI:InChI=1S/C9H7N5O2/c10-9-12-8(5-11-13-9)6-1-3-7(4-2-6)14(15)16/h1-5H,(H2,10,12,13)
InChI key:InChIKey=SFENYYGTKANNSV-UHFFFAOYSA-N
SMILES:NC=1N=C(C2=CC=C(N(=O)=O)C=C2)C=NN1
Synonyms:
  • 1,2,4-Triazin-3-amine, 5-(4-nitrophenyl)-
  • 5-(4-Nitrophenyl)-1,2,4-triazin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.