CAS 886497-49-0
:Ethyl 4-(3-bromophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate
Description:
Ethyl 4-(3-bromophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which contributes to its biological activity and potential applications in medicinal chemistry. The presence of the bromophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many thiazole derivatives. Its structure suggests potential reactivity due to the presence of the carbonyl and ester functional groups, making it a candidate for further chemical modifications. Additionally, compounds of this nature are often investigated for their pharmacological properties, including antimicrobial and anti-inflammatory activities. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a class of thiazole derivatives that are of interest in synthetic and medicinal chemistry.
Formula:C12H10BrNO3S
InChI:InChI=1S/C12H10BrNO3S/c1-2-17-11(15)10-9(14-12(16)18-10)7-4-3-5-8(13)6-7/h3-6H,2H2,1H3,(H,14,16)
InChI key:InChIKey=OUAFBGLEHISQHC-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(NC(=O)S1)C2=CC(Br)=CC=C2
Synonyms:- Ethyl 4-(3-bromophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate
- 5-Thiazolecarboxylic acid, 4-(3-bromophenyl)-2,3-dihydro-2-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(3-Bromo-phenyl)-2-oxo-2,3-dihydro-thiazole-5-carboxylic acid ethyl ester
CAS:Formula:C12H10BrNO3SMolecular weight:328.18
