CymitQuimica logo

CAS 886497-52-5

:

Ethyl 4-(2,4-dichlorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate

Description:
Ethyl 4-(2,4-dichlorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate, with the CAS number 886497-52-5, is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity. This compound features a dichlorophenyl group, enhancing its lipophilicity and potential interactions with biological targets. The presence of the ethyl ester functional group suggests that it may exhibit moderate solubility in organic solvents while being less soluble in water. The thiazole moiety is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory properties. Additionally, the compound's structure indicates potential reactivity due to the carbonyl group, which may participate in nucleophilic addition reactions. Overall, this compound's unique structural features make it of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. However, specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C12H9Cl2NO3S
InChI:InChI=1S/C12H9Cl2NO3S/c1-2-18-11(16)10-9(15-12(17)19-10)7-4-3-6(13)5-8(7)14/h3-5H,2H2,1H3,(H,15,17)
InChI key:InChIKey=MDPWOFIWBYHIPH-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(NC(=O)S1)C2=C(Cl)C=C(Cl)C=C2
Synonyms:
  • 5-Thiazolecarboxylic acid, 4-(2,4-dichlorophenyl)-2,3-dihydro-2-oxo-, ethyl ester
  • Ethyl 4-(2,4-dichlorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.