CAS 886497-55-8

Ethyl 4-methyl-2-[(1-methylpropyl)amino]-5-thiazolecarboxylate

Description:

Ethyl 4-methyl-2-[(1-methylpropyl)amino]-5-thiazolecarboxylate, identified by its CAS number 886497-55-8, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a 4-methyl group and a 1-methylpropyl amino substituent enhances its steric and electronic properties, potentially influencing its biological activity. Typically, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The thiazole moiety is often associated with various biological activities, including antimicrobial and anti-inflammatory effects. Additionally, the compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its behavior in different environments. Overall, the unique combination of functional groups and the thiazole framework contribute to the compound's potential applications in drug development and other chemical research areas.

Formula: C₁₁H₁₈N₂O₂S

InChI: InChI=1S/C11H18N2O2S/c1-5-7(3)12-11-13-8(4)9(16-11)10(14)15-6-2/h7H,5-6H2,1-4H3,(H,12,13)

InChI key: InChIKey=HDOCOQMXSUHAGL-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1SC(NC(CC)C)=NC1C

Synonyms:

• Ethyl 4-methyl-2-[(1-methylpropyl)amino]-5-thiazolecarboxylate
• 5-Thiazolecarboxylic acid, 4-methyl-2-[(1-methylpropyl)amino]-, ethyl ester