CAS 886497-64-9
:Ethyl 2-(butylamino)-4-methyl-5-thiazolecarboxylate
Description:
Ethyl 2-(butylamino)-4-methyl-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which contributes to its biological activity and potential applications in medicinal chemistry. The presence of the ethyl ester group enhances its solubility and reactivity, making it suitable for various chemical reactions. The butylamino substituent introduces a hydrophobic character, which can influence the compound's interaction with biological targets. This compound may exhibit properties such as antimicrobial or anti-inflammatory activity, typical of thiazole derivatives. Its molecular structure suggests potential for use in drug development, particularly in the synthesis of compounds targeting specific enzymes or receptors. As with many thiazole derivatives, it may also be of interest in agricultural chemistry for its potential as a pesticide or herbicide. Safety and handling precautions should be observed, as with all chemical substances, due to the potential for toxicity or environmental impact. Further studies would be necessary to fully elucidate its pharmacological properties and applications.
Formula:C11H18N2O2S
InChI:InChI=1S/C11H18N2O2S/c1-4-6-7-12-11-13-8(3)9(16-11)10(14)15-5-2/h4-7H2,1-3H3,(H,12,13)
InChI key:InChIKey=DTTJRKCVQMPVFF-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1SC(NCCCC)=NC1C
Synonyms:- Ethyl 2-(butylamino)-4-methyl-5-thiazolecarboxylate
- 5-Thiazolecarboxylic acid, 2-(butylamino)-4-methyl-, ethyl ester
- Ethyl 2-(butylamino)-4-methyl-1,3-thiazole-5-carboxylate
- ART-CHEM-BB B028588
- 2-BUTYLAMINO-4-METHYL-THIAZOLE-5-CARBOXYLIC ACID ETHYL ESTER
- AKOS B028588
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery