CAS 886497-70-7

Methyl 7-cyclopropylpyrazolo[1,5-a]pyrimidine-2-carboxylate

Description:

Methyl 7-cyclopropylpyrazolo[1,5-a]pyrimidine-2-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features a cyclopropyl group, contributing to its potential biological activity and influencing its steric and electronic properties. The presence of the methyl ester functional group at the carboxylate position enhances its solubility and reactivity, making it a candidate for various chemical reactions and applications in medicinal chemistry. The compound's structure suggests potential interactions with biological targets, which may lead to pharmacological effects. Its CAS number, 886497-70-7, allows for easy identification in chemical databases and literature. As with many heterocyclic compounds, its synthesis and characterization are of interest in the development of new therapeutic agents, particularly in the fields of oncology and neurology, where pyrazolo and pyrimidine derivatives have shown promise. Further studies would be necessary to elucidate its specific properties, including its stability, reactivity, and biological activity.

Formula: C₁₁H₁₁N₃O₂

InChI: InChI=1S/C11H11N3O2/c1-16-11(15)8-6-10-12-5-4-9(7-2-3-7)14(10)13-8/h4-7H,2-3H2,1H3

InChI key: InChIKey=LMGDCQPGJBSJMD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=NN2C(=CC=NC2=C1)C3CC3

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 7-cyclopropyl-, methyl ester
• Methyl 7-cyclopropylpyrazolo[1,5-a]pyrimidine-2-carboxylate