CymitQuimica logo

CAS 886497-86-5

:

Ethyl 4-(3,4-dimethoxyphenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate

Description:
Ethyl 4-(3,4-dimethoxyphenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which contributes to its biological activity and potential pharmacological properties. The presence of the ethyl ester group enhances its solubility and reactivity, making it suitable for various synthetic applications. The dimethoxyphenyl substituent indicates the presence of methoxy groups on the aromatic ring, which can influence the compound's electronic properties and steric hindrance, potentially affecting its interaction with biological targets. This compound may exhibit diverse biological activities, including anti-inflammatory or antimicrobial effects, due to the thiazole moiety, which is known for its role in medicinal chemistry. Its structural complexity and functional groups suggest that it could be a candidate for further research in drug development or as a lead compound in the synthesis of novel therapeutic agents. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific conditions and environments.
Formula:C14H15NO5S
InChI:InChI=1S/C14H15NO5S/c1-4-20-13(16)12-11(15-14(17)21-12)8-5-6-9(18-2)10(7-8)19-3/h5-7H,4H2,1-3H3,(H,15,17)
InChI key:InChIKey=UXMXGLYGUCLHIU-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(NC(=O)S1)C2=CC(OC)=C(OC)C=C2
Synonyms:
  • Ethyl 4-(3,4-dimethoxyphenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate
  • 5-Thiazolecarboxylic acid, 4-(3,4-dimethoxyphenyl)-2,3-dihydro-2-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.