CAS 886497-91-2

(4-Amino-1-piperidinyl)-4-pyridinylmethanone

Description:

(4-Amino-1-piperidinyl)-4-pyridinylmethanone, identified by its CAS number 886497-91-2, is a chemical compound characterized by its structural features that include a piperidine ring and a pyridine moiety. This compound typically exhibits properties associated with amines and ketones, such as basicity due to the presence of the amino group and potential reactivity due to the carbonyl functionality. It is likely to be soluble in polar solvents, reflecting the presence of nitrogen atoms that can engage in hydrogen bonding. The compound may also demonstrate biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery contexts. As with many organic compounds, stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₁₅N₃O

InChI: InChI=1S/C11H15N3O/c12-10-3-7-14(8-4-10)11(15)9-1-5-13-6-2-9/h1-2,5-6,10H,3-4,7-8,12H2

InChI key: InChIKey=URGXEIDULPADAB-UHFFFAOYSA-N

SMILES: C(=O)(N1CCC(N)CC1)C=2C=CN=CC2

Synonyms:

• 4-Piperidinamine, 1-(4-pyridinylcarbonyl)-
• (4-Amino-1-piperidinyl)-4-pyridinylmethanone
• Methanone, (4-amino-1-piperidinyl)-4-pyridinyl-

(4-Amino-piperidin-1-yl)-pyridin-4-yl-methanone

CAS: 886497-91-2

Formula: C₁₁H₁₅N₃O

Purity: 97%

Molecular weight: 205.261

Ref: 10-F031024