
CAS 886497-96-7
:5-Bromo-2-(1-methylcyclopropyl)benzenamine
Description:
5-Bromo-2-(1-methylcyclopropyl)benzenamine is an organic compound characterized by its aromatic structure, featuring a bromine substituent and an amine group. The presence of the bromine atom at the 5-position of the benzene ring contributes to its reactivity and potential applications in various chemical reactions, such as electrophilic substitution. The 2-position amine group enhances the compound's nucleophilicity, making it useful in synthetic organic chemistry. The 1-methylcyclopropyl group introduces a unique three-membered ring structure, which can influence the compound's steric and electronic properties. This compound may exhibit interesting biological activities, making it a candidate for pharmaceutical research. Its solubility and stability in various solvents can vary, depending on the specific conditions and the presence of functional groups. Overall, 5-Bromo-2-(1-methylcyclopropyl)benzenamine is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C10H12BrN
InChI:InChI=1S/C10H12BrN/c1-10(4-5-10)8-3-2-7(11)6-9(8)12/h2-3,6H,4-5,12H2,1H3
InChI key:InChIKey=QWSRENZWXGPFNE-UHFFFAOYSA-N
SMILES:CC1(C2=C(N)C=C(Br)C=C2)CC1
Synonyms:- Benzenamine, 5-bromo-2-(1-methylcyclopropyl)-
- 5-Bromo-2-(1-methylcyclopropyl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.