CymitQuimica logo

CAS 886498-04-0

:

Ethyl 2,3-dihydro-4-(4-methylphenyl)-2-oxo-5-thiazolecarboxylate

Description:
Ethyl 2,3-dihydro-4-(4-methylphenyl)-2-oxo-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of a 4-methylphenyl substituent indicates that it has an aromatic character, which can influence its reactivity and interaction with other molecules. The thiazole moiety is known for its biological activity, often exhibiting antimicrobial, antifungal, or anticancer properties. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where thiazole derivatives are frequently explored for their therapeutic effects. Additionally, the presence of the carbonyl group (2-oxo) enhances its reactivity, making it a potential candidate for further chemical modifications. Overall, this compound's unique structural features and functional groups contribute to its potential utility in various chemical and biological applications.
Formula:C13H13NO3S
InChI:InChI=1S/C13H13NO3S/c1-3-17-12(15)11-10(14-13(16)18-11)9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3,(H,14,16)
InChI key:InChIKey=PCFOOWJIQROZKM-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(NC(=O)S1)C2=CC=C(C)C=C2
Synonyms:
  • 5-Thiazolecarboxylic acid, 2,3-dihydro-4-(4-methylphenyl)-2-oxo-, ethyl ester
  • Ethyl 2,3-dihydro-4-(4-methylphenyl)-2-oxo-5-thiazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.