
CAS 886498-14-2
:Ethyl 4-(2-chlorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate
Description:
Ethyl 4-(2-chlorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate, identified by its CAS number 886498-14-2, is a chemical compound characterized by its thiazole ring structure, which incorporates both a carboxylate and an ethyl ester functional group. This compound features a 2-chlorophenyl substituent, contributing to its potential biological activity and reactivity. The thiazole moiety is known for its presence in various pharmaceuticals and agrochemicals, often exhibiting antimicrobial and antifungal properties. The presence of the ethyl ester enhances its solubility and may influence its pharmacokinetic properties. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the purity and specific conditions under which it is studied. Overall, this compound represents a class of thiazole derivatives that are of interest in medicinal chemistry and material science.
Formula:C12H10ClNO3S
InChI:InChI=1S/C12H10ClNO3S/c1-2-17-11(15)10-9(14-12(16)18-10)7-5-3-4-6-8(7)13/h3-6H,2H2,1H3,(H,14,16)
InChI key:InChIKey=WPPIKCCYRDJSKK-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(NC(=O)S1)C2=C(Cl)C=CC=C2
Synonyms:- Ethyl 4-(2-chlorophenyl)-2,3-dihydro-2-oxo-5-thiazolecarboxylate
- 5-Thiazolecarboxylic acid, 4-(2-chlorophenyl)-2,3-dihydro-2-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.