
CAS 886498-23-3
:Ethyl 4-methyl-2-[(2-methylpropyl)amino]-5-thiazolecarboxylate
Description:
Ethyl 4-methyl-2-[(2-methylpropyl)amino]-5-thiazolecarboxylate, with the CAS number 886498-23-3, is a chemical compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing sulfur and nitrogen. This substance features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a 2-methylpropyl amino group indicates that it has potential for biological activity, possibly influencing its pharmacological properties. The thiazolecarboxylate moiety suggests that it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific arrangement of substituents on the thiazole ring can significantly affect the compound's biological activity, making it a subject of interest in drug discovery and development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H18N2O2S
InChI:InChI=1S/C11H18N2O2S/c1-5-15-10(14)9-8(4)13-11(16-9)12-6-7(2)3/h7H,5-6H2,1-4H3,(H,12,13)
InChI key:InChIKey=XRQPOKHREJACRC-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1SC(NCC(C)C)=NC1C
Synonyms:- Ethyl 4-methyl-2-[(2-methylpropyl)amino]-5-thiazolecarboxylate
- 5-Thiazolecarboxylic acid, 4-methyl-2-[(2-methylpropyl)amino]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.