CAS 886498-27-7

Ethyl 2-[(1-methylpropyl)amino]-4-(trifluoromethyl)-5-thiazolecarboxylate

Description:

Ethyl 2-[(1-methylpropyl)amino]-4-(trifluoromethyl)-5-thiazolecarboxylate, identified by its CAS number 886498-27-7, is a chemical compound that belongs to the thiazole family. This substance features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen atoms. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The ethyl ester functional group contributes to its solubility and reactivity, making it a potential candidate for various chemical reactions. The 1-methylpropylamino substituent suggests that the compound may exhibit interesting pharmacological properties, possibly acting as a ligand or inhibitor in biological systems. Its unique structure may also confer specific characteristics such as stability under certain conditions and potential interactions with other molecules. Overall, this compound's distinct functional groups and structural features make it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₁H₁₅F₃N₂O₂S

InChI: InChI=1S/C11H15F3N2O2S/c1-4-6(3)15-10-16-8(11(12,13)14)7(19-10)9(17)18-5-2/h6H,4-5H2,1-3H3,(H,15,16)

InChI key: InChIKey=MNQKKVDRDKOAGO-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(C(OCC)=O)SC(NC(CC)C)=N1

Synonyms:

• Ethyl 2-[(1-methylpropyl)amino]-4-(trifluoromethyl)-5-thiazolecarboxylate
• 5-Thiazolecarboxylic acid, 2-[(1-methylpropyl)amino]-4-(trifluoromethyl)-, ethyl ester