CAS 886498-33-5

2-Hydroxy-3,6-dimethyl-5-nitrobenzaldehyde

Description:

2-Hydroxy-3,6-dimethyl-5-nitrobenzaldehyde, with the CAS number 886498-33-5, is an organic compound characterized by its aromatic structure featuring a benzaldehyde functional group. This compound contains a hydroxyl group (-OH), a nitro group (-NO2), and two methyl groups (-CH3) attached to the benzene ring, which contribute to its chemical reactivity and physical properties. The presence of the hydroxyl group imparts some degree of polarity, making it more soluble in polar solvents compared to non-polar solvents. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the methyl groups can provide steric hindrance, affecting the compound's overall reactivity and stability. This compound may be utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals or agrochemicals, due to its unique functional groups and structural characteristics. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₉NO₄

InChI: InChI=1S/C9H9NO4/c1-5-3-8(10(13)14)6(2)7(4-11)9(5)12/h3-4,12H,1-2H3

InChI key: InChIKey=ORYYDLKPTWIWDF-UHFFFAOYSA-N

SMILES: C(=O)C1=C(C)C(N(=O)=O)=CC(C)=C1O

Synonyms:

• 2-Hydroxy-3,6-dimethyl-5-nitrobenzaldehyde
• Benzaldehyde, 2-hydroxy-3,6-dimethyl-5-nitro-