
CAS 886498-37-9
:2-[[5-Ethyl-4-(1-naphthalenyl)-4H-1,2,4-triazol-3-yl]thio]acetic acid
Description:
2-[[5-Ethyl-4-(1-naphthalenyl)-4H-1,2,4-triazol-3-yl]thio]acetic acid is a chemical compound characterized by its unique structure, which includes a triazole ring and a naphthalene moiety. This compound features a thioether linkage, contributing to its potential reactivity and biological activity. The presence of the ethyl group and the naphthalene ring enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. As an acetic acid derivative, it possesses acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of antifungal or antimicrobial agents. Its specific interactions and mechanisms of action would depend on further studies, including in vitro and in vivo evaluations. Overall, 2-[[5-Ethyl-4-(1-naphthalenyl)-4H-1,2,4-triazol-3-yl]thio]acetic acid represents a class of compounds that could have significant applications in pharmaceuticals and agrochemicals.
Formula:C16H15N3O2S
InChI:InChI=1S/C16H15N3O2S/c1-2-14-17-18-16(22-10-15(20)21)19(14)13-9-5-7-11-6-3-4-8-12(11)13/h3-9H,2,10H2,1H3,(H,20,21)
InChI key:InChIKey=IMTHSDSGEAJKNI-UHFFFAOYSA-N
SMILES:S(CC(O)=O)C=1N(C(CC)=NN1)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- Acetic acid, 2-[[5-ethyl-4-(1-naphthalenyl)-4H-1,2,4-triazol-3-yl]thio]-
- 2-[[5-Ethyl-4-(1-naphthalenyl)-4H-1,2,4-triazol-3-yl]thio]acetic acid
- Acetic acid, [[5-ethyl-4-(1-naphthalenyl)-4H-1,2,4-triazol-3-yl]thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.