CymitQuimica logo

CAS 886498-61-9

:

4-Fluoro-2-methoxyphenylacetic acid

Description:
4-Fluoro-2-methoxyphenylacetic acid is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a methoxy group attached to a phenyl ring. The presence of the carboxylic acid functional group (-COOH) contributes to its acidic properties. This compound typically exhibits moderate solubility in polar solvents due to the hydrophilic nature of the carboxylic acid, while the methoxy group can enhance its solubility in organic solvents. The fluorine substituent can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering pharmacokinetic properties. 4-Fluoro-2-methoxyphenylacetic acid may be of interest in medicinal chemistry and drug development, particularly for its potential therapeutic applications. Its synthesis and characterization involve standard organic chemistry techniques, including nucleophilic substitution and functional group transformations. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C9H9FO3
InChI:InChI=1S/C9H9FO3/c1-13-8-5-7(10)3-2-6(8)4-9(11)12/h2-3,5H,4H2,1H3,(H,11,12)
InChI key:TUHNRCPWPMJXQN-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)F)CC(=O)O
Found 5 products.