CAS 886498-76-6

2-[(6-Chloro-4-methyl-2-quinolinyl)thio]acetic acid

Description:

2-[(6-Chloro-4-methyl-2-quinolinyl)thio]acetic acid is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with a chlorine atom and a methyl group, along with a thioacetic acid functional group. This compound typically exhibits properties associated with both quinoline derivatives and thiol-containing acids, such as potential biological activity and solubility in organic solvents. The presence of the chlorine atom may influence its reactivity and interaction with biological targets, while the thioacetic acid group can participate in various chemical reactions, including nucleophilic substitutions and esterifications. The compound's molecular weight, melting point, and solubility characteristics are influenced by its specific functional groups and overall structure. Additionally, compounds of this nature may be of interest in medicinal chemistry for their potential pharmacological properties, including antimicrobial or anti-inflammatory activities. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.

Formula: C₁₂H₁₀ClNO₂S

InChI: InChI=1S/C12H10ClNO2S/c1-7-4-11(17-6-12(15)16)14-10-3-2-8(13)5-9(7)10/h2-5H,6H2,1H3,(H,15,16)

InChI key: InChIKey=RXVDODTYPKNXHU-UHFFFAOYSA-N

SMILES: CC=1C2=C(N=C(SCC(O)=O)C1)C=CC(Cl)=C2

Synonyms:

• Acetic acid, [(6-chloro-4-methyl-2-quinolinyl)thio]-
• 2-[(6-Chloro-4-methyl-2-quinolinyl)thio]acetic acid
• Acetic acid, 2-[(6-chloro-4-methyl-2-quinolinyl)thio]-