CAS 886499-00-9

4-[(2,5,6-Trimethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid

Description:

4-[(2,5,6-Trimethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid, with the CAS number 886499-00-9, is a chemical compound characterized by its unique structure that includes a thieno[2,3-d]pyrimidine moiety and an amino butanoic acid side chain. This compound typically exhibits properties associated with both heterocyclic and amino acids, which may influence its solubility, stability, and reactivity. The presence of the thieno and pyrimidine rings suggests potential biological activity, possibly as a pharmaceutical agent or a biochemical probe. The trimethyl groups on the thieno-pyrimidine structure may enhance lipophilicity, affecting its interaction with biological membranes. Additionally, the butanoic acid component introduces a carboxylic acid functional group, which can participate in hydrogen bonding and ionic interactions, potentially influencing the compound's pharmacokinetics and pharmacodynamics. Overall, this compound's characteristics make it of interest in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways or receptors.

Formula: C₁₃H₁₇N₃O₂S

InChI: InChI=1S/C13H17N3O2S/c1-7-8(2)19-13-11(7)12(15-9(3)16-13)14-6-4-5-10(17)18/h4-6H2,1-3H3,(H,17,18)(H,14,15,16)

InChI key: InChIKey=DQTKDEYWIIICQF-UHFFFAOYSA-N

SMILES: N(CCCC(O)=O)C1=C2C(SC(C)=C2C)=NC(C)=N1

Synonyms:

• Butanoic acid, 4-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)amino]-
• 4-[(2,5,6-Trimethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid