
CAS 886499-05-4
:4-[(5,6-Dimethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid
Description:
4-[(5,6-Dimethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid, with the CAS number 886499-05-4, is a chemical compound characterized by its unique structure that includes a thieno[2,3-d]pyrimidine moiety and an amino butanoic acid side chain. This compound typically exhibits properties associated with both heterocyclic and amino acids, which may influence its solubility, reactivity, and biological activity. The presence of the dimethyl groups on the thieno[2,3-d]pyrimidine ring can enhance lipophilicity, potentially affecting its pharmacokinetic properties. As a derivative of butanoic acid, it may participate in various chemical reactions, including amide formation and coupling reactions. The compound's biological relevance may be linked to its potential as a pharmaceutical agent, possibly acting on specific biological pathways or targets due to its structural features. Overall, its characteristics make it a subject of interest in medicinal chemistry and drug development, although specific applications would depend on further research and investigation into its biological activity and efficacy.
Formula:C12H15N3O2S
InChI:InChI=1S/C12H15N3O2S/c1-7-8(2)18-12-10(7)11(14-6-15-12)13-5-3-4-9(16)17/h6H,3-5H2,1-2H3,(H,16,17)(H,13,14,15)
InChI key:InChIKey=YDXILAYDGUDULT-UHFFFAOYSA-N
SMILES:N(CCCC(O)=O)C1=C2C(SC(C)=C2C)=NC=N1
Synonyms:- 4-[(5,6-Dimethylthieno[2,3-d]pyrimidin-4-yl)amino]butanoic acid
- Butanoic acid, 4-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.