CAS 886499-38-3

2-[[2-(3-Formyl-1H-indol-1-yl)acetyl]amino]benzoic acid

Description:

2-[[2-(3-Formyl-1H-indol-1-yl)acetyl]amino]benzoic acid, with the CAS number 886499-38-3, is a chemical compound characterized by its complex structure, which includes an indole moiety and an amino acid derivative. This compound features a benzoic acid functional group, which contributes to its acidic properties. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation or reduction. The indole structure is known for its biological significance, often found in various natural products and pharmaceuticals, suggesting potential bioactivity. The compound's solubility and stability can vary depending on the pH and solvent used, which is important for its application in research and development. Additionally, the presence of multiple functional groups may allow for further derivatization, making it a versatile candidate for synthetic chemistry and medicinal chemistry applications. Overall, this compound's unique structural features may contribute to its potential utility in various scientific fields, including drug discovery and development.

Formula: C₁₈H₁₄N₂O₄

InChI: InChI=1S/C18H14N2O4/c21-11-12-9-20(16-8-4-2-5-13(12)16)10-17(22)19-15-7-3-1-6-14(15)18(23)24/h1-9,11H,10H2,(H,19,22)(H,23,24)

InChI key: InChIKey=NVDVVIDEOJOMBW-UHFFFAOYSA-N

SMILES: C(C(NC1=C(C(O)=O)C=CC=C1)=O)N2C=3C(C(C=O)=C2)=CC=CC3

Synonyms:

• 2-[[2-(3-Formyl-1H-indol-1-yl)acetyl]amino]benzoic acid
• Benzoic acid, 2-[[(3-formyl-1H-indol-1-yl)acetyl]amino]-
• Benzoic acid, 2-[[2-(3-formyl-1H-indol-1-yl)acetyl]amino]-