CAS 886499-41-8

2-[(8-Methoxy-4-methyl-2-quinolinyl)thio]acetic acid

Description:

2-[(8-Methoxy-4-methyl-2-quinolinyl)thio]acetic acid, with the CAS number 886499-41-8, is a chemical compound characterized by its unique structure that includes a quinoline moiety, a methoxy group, and a thioacetic acid functional group. This compound typically exhibits properties associated with both quinoline derivatives and thioacetic acids, such as potential biological activity and solubility in organic solvents. The presence of the methoxy and methyl groups may influence its lipophilicity and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the thioether linkage can impart specific chemical reactivity, potentially allowing for interactions with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be studied for its pharmacological properties, including antimicrobial or anti-inflammatory activities. As with many compounds in this class, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₃H₁₃NO₃S

InChI: InChI=1S/C13H13NO3S/c1-8-6-11(18-7-12(15)16)14-13-9(8)4-3-5-10(13)17-2/h3-6H,7H2,1-2H3,(H,15,16)

InChI key: InChIKey=LRTZNVUHWHMUSK-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C(C)=CC(SCC(O)=O)=N2)C=CC1

Synonyms:

• Acetic acid, 2-[(8-methoxy-4-methyl-2-quinolinyl)thio]-
• 2-[(8-Methoxy-4-methyl-2-quinolinyl)thio]acetic acid
• Acetic acid, [(8-methoxy-4-methyl-2-quinolinyl)thio]-