
CAS 886499-56-5
:N-(2-Chlorophenyl)-3-formyl-1H-indole-1-acetamide
Description:
N-(2-Chlorophenyl)-3-formyl-1H-indole-1-acetamide is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a formyl group (-CHO) at the 3-position and an acetamide group (-C(=O)NH2) at the 1-position contributes to its reactivity and potential biological activity. The 2-chlorophenyl substituent introduces a chlorine atom, which can influence the compound's electronic properties and interactions with biological targets. This compound may exhibit properties such as antimicrobial, anticancer, or anti-inflammatory activities, making it of interest in medicinal chemistry. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can affect its solubility and stability. The compound's synthesis and characterization typically involve standard organic chemistry techniques, and its applications may extend to drug development or as a research tool in biochemical studies. As with many indole derivatives, the specific characteristics and activities can vary based on the substituents and their positions on the indole ring.
Formula:C17H13ClN2O2
InChI:InChI=1S/C17H13ClN2O2/c18-14-6-2-3-7-15(14)19-17(22)10-20-9-12(11-21)13-5-1-4-8-16(13)20/h1-9,11H,10H2,(H,19,22)
InChI key:InChIKey=WAJFNGHZWDUJEC-UHFFFAOYSA-N
SMILES:C(C(NC1=C(Cl)C=CC=C1)=O)N2C=3C(C(C=O)=C2)=CC=CC3
Synonyms:- N-(2-Chlorophenyl)-3-formyl-1H-indole-1-acetamide
- 1H-Indole-1-acetamide, N-(2-chlorophenyl)-3-formyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.