CAS 886500-05-6

N-(6,7-Dimethoxy-4-quinazolinyl)glycine

Description:

N-(6,7-Dimethoxy-4-quinazolinyl)glycine is a chemical compound characterized by its unique structure, which includes a quinazoline moiety substituted with two methoxy groups at the 6 and 7 positions, along with a glycine functional group. This compound is typically classified as an amino acid derivative due to the presence of the glycine component. It may exhibit biological activity, potentially acting as a ligand or modulator in various biochemical pathways. The presence of the quinazoline ring suggests potential pharmacological properties, as quinazoline derivatives are often studied for their roles in medicinal chemistry, particularly in the development of anti-cancer and anti-inflammatory agents. The methoxy groups can influence the compound's solubility, stability, and interaction with biological targets. As with many chemical substances, its properties, such as solubility, melting point, and reactivity, would depend on the specific conditions under which it is studied. Further research would be necessary to fully elucidate its potential applications and mechanisms of action in biological systems.

Formula: C₁₂H₁₃N₃O₄

InChI: InChI=1S/C12H13N3O4/c1-18-9-3-7-8(4-10(9)19-2)14-6-15-12(7)13-5-11(16)17/h3-4,6H,5H2,1-2H3,(H,16,17)(H,13,14,15)

InChI key: InChIKey=DPSDVOWWEDAMQB-UHFFFAOYSA-N

SMILES: N(CC(O)=O)C=1C2=C(C=C(OC)C(OC)=C2)N=CN1

Synonyms:

• Glycine, N-(6,7-dimethoxy-4-quinazolinyl)-
• N-(6,7-Dimethoxy-4-quinazolinyl)glycine
• (6,7-Dimethoxy-quinazolin-4-ylamino)-acetic acid
• 2-[(6,7-Dimethoxyquinazolin-4-yl)amino]acetic acid