CAS 886500-10-3

4-[(6,8-Dibromo-4-quinazolinyl)amino]butanoic acid

Description:

4-[(6,8-Dibromo-4-quinazolinyl)amino]butanoic acid is a chemical compound characterized by its unique structure, which includes a quinazoline moiety substituted with bromine atoms at the 6 and 8 positions, along with an amino group and a butanoic acid side chain. This compound is likely to exhibit properties typical of both amino acids and heterocyclic aromatic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid group. The bromine substitutions may impart specific electronic and steric effects, influencing its reactivity and biological activity. Such compounds are often investigated for their potential pharmacological applications, particularly in medicinal chemistry, where modifications to the quinazoline structure can lead to varied biological activities. Additionally, the presence of multiple halogen atoms can enhance lipophilicity and alter the compound's interaction with biological targets. Overall, 4-[(6,8-Dibromo-4-quinazolinyl)amino]butanoic acid represents a complex structure with potential utility in various chemical and biological contexts.

Formula: C₁₂H₁₁Br₂N₃O₂

InChI: InChI=1S/C12H11Br2N3O2/c13-7-4-8-11(9(14)5-7)16-6-17-12(8)15-3-1-2-10(18)19/h4-6H,1-3H2,(H,18,19)(H,15,16,17)

InChI key: InChIKey=BLZFANFOKIJQGS-UHFFFAOYSA-N

SMILES: N(CCCC(O)=O)C=1C2=C(C(Br)=CC(Br)=C2)N=CN1

Synonyms:

• 4-[(6,8-Dibromo-4-quinazolinyl)amino]butanoic acid
• Butanoic acid, 4-[(6,8-dibromo-4-quinazolinyl)amino]-