
CAS 886500-32-9
:2-[(3-Ethyl-3,4-dihydro-6,7-dimethoxy-4-oxo-2-quinazolinyl)thio]acetic acid
Description:
2-[(3-Ethyl-3,4-dihydro-6,7-dimethoxy-4-oxo-2-quinazolinyl)thio]acetic acid is a chemical compound characterized by its complex structure, which includes a quinazoline core modified with ethyl and methoxy groups, as well as a thioacetic acid moiety. This compound typically exhibits properties associated with both quinazoline derivatives and thioacetic acids, such as potential biological activity and solubility in organic solvents. The presence of the methoxy groups may enhance lipophilicity, influencing its pharmacokinetic properties. Additionally, the thioacetic acid functional group can participate in various chemical reactions, including nucleophilic substitutions and esterifications. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific data regarding its reactivity, stability, and biological activity would require further investigation through experimental studies. As with many synthetic compounds, safety and handling precautions should be observed, given the potential for toxicity or reactivity associated with its functional groups.
Formula:C14H16N2O5S
InChI:InChI=1S/C14H16N2O5S/c1-4-16-13(19)8-5-10(20-2)11(21-3)6-9(8)15-14(16)22-7-12(17)18/h5-6H,4,7H2,1-3H3,(H,17,18)
InChI key:InChIKey=DVAZUXXIPNYLAJ-UHFFFAOYSA-N
SMILES:O=C1C=2C(N=C(SCC(O)=O)N1CC)=CC(OC)=C(OC)C2
Synonyms:- Acetic acid, [(3-ethyl-3,4-dihydro-6,7-dimethoxy-4-oxo-2-quinazolinyl)thio]-
- 2-[(3-Ethyl-3,4-dihydro-6,7-dimethoxy-4-oxo-2-quinazolinyl)thio]acetic acid
- Acetic acid, 2-[(3-ethyl-3,4-dihydro-6,7-dimethoxy-4-oxo-2-quinazolinyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.