CAS 886500-42-1

2-[(6,8-Dichloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]acetic acid

Description:

2-[(6,8-Dichloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]acetic acid is a chemical compound characterized by its unique structure, which includes a quinazoline core substituted with dichloro and ethyl groups, as well as a thioacetic acid moiety. This compound typically exhibits properties associated with both quinazoline derivatives and thioacetic acids, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the quinazoline ring, which is known for its pharmacological significance. The dichloro substitutions may enhance its reactivity and influence its interaction with biological targets. Additionally, the thio group can impart unique chemical reactivity, making it a candidate for further chemical modifications or applications in medicinal chemistry. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular structure. As with many synthetic compounds, safety and handling precautions are essential when working with this substance in a laboratory setting.

Formula: C₁₂H₁₀Cl₂N₂O₃S

InChI: InChI=1S/C12H10Cl2N2O3S/c1-2-16-11(19)7-3-6(13)4-8(14)10(7)15-12(16)20-5-9(17)18/h3-4H,2,5H2,1H3,(H,17,18)

InChI key: InChIKey=OJBUMMTWKBIDFB-UHFFFAOYSA-N

SMILES: O=C1C=2C(=C(Cl)C=C(Cl)C2)N=C(SCC(O)=O)N1CC

Synonyms:

• 2-[(6,8-Dichloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]acetic acid
• Acetic acid, [(6,8-dichloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]-
• Acetic acid, 2-[(6,8-dichloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]-