
CAS 886500-56-7
:2-[(7-Chloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]acetic acid
Description:
2-[(7-Chloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]acetic acid is a chemical compound characterized by its unique structure, which includes a quinazoline moiety and a thioacetic acid functional group. The presence of a chlorine atom and an ethyl group contributes to its biological activity and potential pharmacological properties. This compound is likely to exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group, while the quinazoline ring may impart some hydrophobic characteristics. The thioether linkage can enhance its reactivity and interaction with biological targets. Given its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods. Additionally, the compound's safety profile and potential applications would require further investigation through toxicological studies and biological assays.
Formula:C12H11ClN2O3S
InChI:InChI=1S/C12H11ClN2O3S/c1-2-15-11(18)8-4-3-7(13)5-9(8)14-12(15)19-6-10(16)17/h3-5H,2,6H2,1H3,(H,16,17)
InChI key:InChIKey=YLDAYRFSLOUFDC-UHFFFAOYSA-N
SMILES:O=C1C=2C(N=C(SCC(O)=O)N1CC)=CC(Cl)=CC2
Synonyms:- Acetic acid, 2-[(7-chloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]-
- Acetic acid, [(7-chloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]-
- 2-[(7-Chloro-3-ethyl-3,4-dihydro-4-oxo-2-quinazolinyl)thio]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.